C24H35N3O2 — CID 162798992
2-methoxy-N-[[(1S,4R,6S)-3-methyl-4-[[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]methyl]-6-propan-2-ylcyclohex-2-en-1-yl]methyl]ethanamine (PubChem CID 162798992) has the molecular formula C24H35N3O2 and a molecular weight of 397.56 g/mol. Its IUPAC name is 2-methoxy-N-[[(1S,4R,6S)-3-methyl-4-[[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]methyl]-6-propan-2-ylcyclohex-2-en-1-yl]methyl]ethanamine.
| Compound Name | 2-methoxy-N-[[(1S,4R,6S)-3-methyl-4-[[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]methyl]-6-propan-2-ylcyclohex-2-en-1-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 162798992 |
| Molecular Formula | C24H35N3O2 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.27 |
| IUPAC Name | 2-methoxy-N-[[(1S,4R,6S)-3-methyl-4-[[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]methyl]-6-propan-2-ylcyclohex-2-en-1-yl]methyl]ethanamine |
| SMILES | COCCNC[C@@H]1C=C(C)[C@@H](Cc2nnc(-c3ccc(C)cc3)o2)C[C@H]1C(C)C |
| InChI | InChI=1S/C24H35N3O2/c1-16(2)22-13-20(18(4)12-21(22)15-25-10-11-28-5)14-23-26-27-24(29-23)19-8-6-17(3)7-9-19/h6-9,12,16,20-22,25H,10-11,13-15H2,1-5H3/t20-,21+,22+/m1/s1 |
| InChIKey | VQERQRGRJPKCGD-FSSWDIPSSA-N |
| XLogP | 4.68 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|