C25H22F2N2O2 — CID 162799315
2-benzyl-8-(2,4-difluorophenyl)-4-methyl-1,3,3a,10a-tetrahydropyrrolo[3,4-b][1,4]benzoxazepin-5-one (PubChem CID 162799315) has the molecular formula C25H22F2N2O2 and a molecular weight of 420.46 g/mol. Its IUPAC name is 2-benzyl-8-(2,4-difluorophenyl)-4-methyl-1,3,3a,10a-tetrahydropyrrolo[3,4-b][1,4]benzoxazepin-5-one.
| Compound Name | 2-benzyl-8-(2,4-difluorophenyl)-4-methyl-1,3,3a,10a-tetrahydropyrrolo[3,4-b][1,4]benzoxazepin-5-one |
|---|---|
| PubChem CID | 162799315 |
| Molecular Formula | C25H22F2N2O2 |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 2-benzyl-8-(2,4-difluorophenyl)-4-methyl-1,3,3a,10a-tetrahydropyrrolo[3,4-b][1,4]benzoxazepin-5-one |
| SMILES | CN1C(=O)c2ccc(-c3ccc(F)cc3F)cc2OC2CN(Cc3ccccc3)CC21 |
| InChI | InChI=1S/C25H22F2N2O2/c1-28-22-14-29(13-16-5-3-2-4-6-16)15-24(22)31-23-11-17(7-9-20(23)25(28)30)19-10-8-18(26)12-21(19)27/h2-12,22,24H,13-15H2,1H3 |
| InChIKey | PCYFZEUNANDUKK-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |