C19H17N3O3 — CID 162801039
(1S)-14-hydroxy-3-(4-hydroxyphenyl)-9-methyl-5,9,14-triazatetracyclo[6.6.1.02,6.011,15]pentadeca-2(6),3,8(15),10-tetraen-7-one (PubChem CID 162801039) has the molecular formula C19H17N3O3 and a molecular weight of 335.36 g/mol. Its IUPAC name is (1S)-14-hydroxy-3-(4-hydroxyphenyl)-9-methyl-5,9,14-triazatetracyclo[6.6.1.02,6.011,15]pentadeca-2(6),3,8(15),10-tetraen-7-one.
| Compound Name | (1S)-14-hydroxy-3-(4-hydroxyphenyl)-9-methyl-5,9,14-triazatetracyclo[6.6.1.02,6.011,15]pentadeca-2(6),3,8(15),10-tetraen-7-one |
|---|---|
| PubChem CID | 162801039 |
| Molecular Formula | C19H17N3O3 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | (1S)-14-hydroxy-3-(4-hydroxyphenyl)-9-methyl-5,9,14-triazatetracyclo[6.6.1.02,6.011,15]pentadeca-2(6),3,8(15),10-tetraen-7-one |
| SMILES | Cn1cc2c3c1C(=O)c1[nH]cc(-c4ccc(O)cc4)c1[C@@H]3N(O)CC2 |
| InChI | InChI=1S/C19H17N3O3/c1-21-9-11-6-7-22(25)17-14(11)18(21)19(24)16-15(17)13(8-20-16)10-2-4-12(23)5-3-10/h2-5,8-9,17,20,23,25H,6-7H2,1H3/t17-/m1/s1 |
| InChIKey | WOQKNZUALZZBRV-QGZVFWFLSA-N |
| XLogP | 2.61 |
| TPSA | 81.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |