C21H29N3O3 — CID 162801473
2-[3-[(6-methyl-1H-benzimidazol-2-yl)methyl]-1-(oxan-4-yl)piperidin-4-yl]acetic acid (PubChem CID 162801473) has the molecular formula C21H29N3O3 and a molecular weight of 371.48 g/mol. Its IUPAC name is 2-[3-[(6-methyl-1H-benzimidazol-2-yl)methyl]-1-(oxan-4-yl)piperidin-4-yl]acetic acid.
| Compound Name | 2-[3-[(6-methyl-1H-benzimidazol-2-yl)methyl]-1-(oxan-4-yl)piperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 162801473 |
| Molecular Formula | C21H29N3O3 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | 2-[3-[(6-methyl-1H-benzimidazol-2-yl)methyl]-1-(oxan-4-yl)piperidin-4-yl]acetic acid |
| SMILES | Cc1ccc2nc(CC3CN(C4CCOCC4)CCC3CC(=O)O)[nH]c2c1 |
| InChI | InChI=1S/C21H29N3O3/c1-14-2-3-18-19(10-14)23-20(22-18)11-16-13-24(17-5-8-27-9-6-17)7-4-15(16)12-21(25)26/h2-3,10,15-17H,4-9,11-13H2,1H3,(H,22,23)(H,25,26) |
| InChIKey | UKEJMTPCTQVIDV-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 78.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |