About N-[[3,4-dihydroxy-1-(methoxymethyl)cyclopentyl]methyl]cyclopropanecarboxamide
N-[[3,4-dihydroxy-1-(methoxymethyl)cyclopentyl]methyl]cyclopropanecarboxamide (PubChem CID 162801779) has the molecular formula C12H21NO4
and a molecular weight of 243.30 g/mol. Its IUPAC name is N-[[3,4-dihydroxy-1-(methoxymethyl)cyclopentyl]methyl]cyclopropanecarboxamide.
Molecular Properties
| Compound Name | N-[[3,4-dihydroxy-1-(methoxymethyl)cyclopentyl]methyl]cyclopropanecarboxamide |
| PubChem CID | 162801779 |
| Molecular Formula | C12H21NO4 |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | N-[[3,4-dihydroxy-1-(methoxymethyl)cyclopentyl]methyl]cyclopropanecarboxamide |
| SMILES | COCC1(CNC(=O)C2CC2)CC(O)C(O)C1 |
| InChI | InChI=1S/C12H21NO4/c1-17-7-12(4-9(14)10(15)5-12)6-13-11(16)8-2-3-8/h8-10,14-15H,2-7H2,1H3,(H,13,16) |
| InChIKey | YADWYRQXVWDRJK-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[[3,4-dihydroxy-1-(methoxymethyl)cyclopentyl]methyl]cyclopropanecarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[3,4-dihydroxy-1-(methoxymethyl)cyclopentyl]methyl]cyclopropanecarboxamide?
The IUPAC name of N-[[3,4-dihydroxy-1-(methoxymethyl)cyclopentyl]methyl]cyclopropanecarboxamide (CID 162801779) is N-[[3,4-dihydroxy-1-(methoxymethyl)cyclopentyl]methyl]cyclopropanecarboxamide.
What is the SMILES notation for N-[[3,4-dihydroxy-1-(methoxymethyl)cyclopentyl]methyl]cyclopropanecarboxamide?
The canonical SMILES for N-[[3,4-dihydroxy-1-(methoxymethyl)cyclopentyl]methyl]cyclopropanecarboxamide is COCC1(CNC(=O)C2CC2)CC(O)C(O)C1.
What is the InChIKey of N-[[3,4-dihydroxy-1-(methoxymethyl)cyclopentyl]methyl]cyclopropanecarboxamide?
The InChIKey is YADWYRQXVWDRJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO4/c1-17-7-12(4-9(14)10(15)5-12)6-13-11(16)8-2-3-8/h8-10,14-15H,2-7H2,1H3,(H,13,16).
What are the key properties of N-[[3,4-dihydroxy-1-(methoxymethyl)cyclopentyl]methyl]cyclopropanecarboxamide?
N-[[3,4-dihydroxy-1-(methoxymethyl)cyclopentyl]methyl]cyclopropanecarboxamide has a molecular weight of 243.30 g/mol, XLogP of -0.34, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[3,4-dihydroxy-1-(methoxymethyl)cyclopentyl]methyl]cyclopropanecarboxamide is sourced from PubChem (CID 162801779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).