C31H29N3O13 — CID 162801931
4-[(diaminomethylideneamino)methyl]-6-[5,6-dihydroxy-2-[4-hydroxy-2-(2-phenylacetyl)phenyl]-4-oxochromen-7-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 162801931) has the molecular formula C31H29N3O13 and a molecular weight of 651.58 g/mol. Its IUPAC name is 4-[(diaminomethylideneamino)methyl]-6-[5,6-dihydroxy-2-[4-hydroxy-2-(2-phenylacetyl)phenyl]-4-oxochromen-7-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | 4-[(diaminomethylideneamino)methyl]-6-[5,6-dihydroxy-2-[4-hydroxy-2-(2-phenylacetyl)phenyl]-4-oxochromen-7-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 162801931 |
| Molecular Formula | C31H29N3O13 |
| Molecular Weight | 651.58 g/mol |
| Exact Mass | 651.17 |
| IUPAC Name | 4-[(diaminomethylideneamino)methyl]-6-[5,6-dihydroxy-2-[4-hydroxy-2-(2-phenylacetyl)phenyl]-4-oxochromen-7-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | NC(N)=NCC1(O)C(O)C(Oc2cc3oc(-c4ccc(O)cc4C(=O)Cc4ccccc4)cc(=O)c3c(O)c2O)OC(C(=O)O)C1O |
| InChI | InChI=1S/C31H29N3O13/c32-30(33)34-12-31(44)26(40)25(28(42)43)47-29(27(31)41)46-21-11-20-22(24(39)23(21)38)18(37)10-19(45-20)15-7-6-14(35)9-16(15)17(36)8-13-4-2-1-3-5-13/h1-7,9-11,25-27,29,35,38-41,44H,8,12H2,(H,42,43)(H4,32,33,34) |
| InChIKey | ASMHPRRSOSTGPW-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 288.82 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.58 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|