C35H35N3O12 — CID 162802036
4-[(diaminomethylideneamino)methyl]-6-[2-[2-(4-ethyl-3,4-dihydronaphthalen-2-yl)-4-hydroxyphenyl]-5,6-dihydroxy-4-oxochromen-7-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 162802036) has the molecular formula C35H35N3O12 and a molecular weight of 689.67 g/mol. Its IUPAC name is 4-[(diaminomethylideneamino)methyl]-6-[2-[2-(4-ethyl-3,4-dihydronaphthalen-2-yl)-4-hydroxyphenyl]-5,6-dihydroxy-4-oxochromen-7-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | 4-[(diaminomethylideneamino)methyl]-6-[2-[2-(4-ethyl-3,4-dihydronaphthalen-2-yl)-4-hydroxyphenyl]-5,6-dihydroxy-4-oxochromen-7-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 162802036 |
| Molecular Formula | C35H35N3O12 |
| Molecular Weight | 689.67 g/mol |
| Exact Mass | 689.22 |
| IUPAC Name | 4-[(diaminomethylideneamino)methyl]-6-[2-[2-(4-ethyl-3,4-dihydronaphthalen-2-yl)-4-hydroxyphenyl]-5,6-dihydroxy-4-oxochromen-7-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | CCC1CC(c2cc(O)ccc2-c2cc(=O)c3c(O)c(O)c(OC4OC(C(=O)O)C(O)C(O)(CN=C(N)N)C4O)cc3o2)=Cc2ccccc21 |
| InChI | InChI=1S/C35H35N3O12/c1-2-15-9-17(10-16-5-3-4-6-19(15)16)21-11-18(39)7-8-20(21)23-12-22(40)26-24(48-23)13-25(27(41)28(26)42)49-33-31(44)35(47,14-38-34(36)37)30(43)29(50-33)32(45)46/h3-8,10-13,15,29-31,33,39,41-44,47H,2,9,14H2,1H3,(H,45,46)(H4,36,37,38) |
| InChIKey | BTROZVUEWOQNGI-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 271.75 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.67 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|