C21H32N2O2S — CID 162802100
(2S)-2-[(4S,4aS,5S,6R,8aR)-5-hydroxy-2,4,8a-trimethyl-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl]-N-methyl-N-prop-2-enylpropanamide (PubChem CID 162802100) has the molecular formula C21H32N2O2S and a molecular weight of 376.57 g/mol. Its IUPAC name is (2S)-2-[(4S,4aS,5S,6R,8aR)-5-hydroxy-2,4,8a-trimethyl-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl]-N-methyl-N-prop-2-enylpropanamide.
| Compound Name | (2S)-2-[(4S,4aS,5S,6R,8aR)-5-hydroxy-2,4,8a-trimethyl-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl]-N-methyl-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 162802100 |
| Molecular Formula | C21H32N2O2S |
| Molecular Weight | 376.57 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | (2S)-2-[(4S,4aS,5S,6R,8aR)-5-hydroxy-2,4,8a-trimethyl-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl]-N-methyl-N-prop-2-enylpropanamide |
| SMILES | C=CCN(C)C(=O)[C@@H](C)[C@H]1CC[C@]2(C)Cc3sc(C)nc3[C@@H](C)[C@@H]2[C@H]1O |
| InChI | InChI=1S/C21H32N2O2S/c1-7-10-23(6)20(25)12(2)15-8-9-21(5)11-16-18(22-14(4)26-16)13(3)17(21)19(15)24/h7,12-13,15,17,19,24H,1,8-11H2,2-6H3/t12-,13-,15+,17+,19-,21+/m0/s1 |
| InChIKey | GICYRZPFXPNTIT-WGSRSINRSA-N |
| XLogP | 3.79 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.57 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|