C42H50N2O4 — CID 162802210
(1R,4S,16R,18S,20S)-20-[(2-amino-4-pyridinyl)methyl]-7-hydroxy-8-methoxy-4-phenyl-18-(1-propylcyclopentyl)tricyclo[14.5.0.05,10]henicosa-5,7,9-trien-2-yne-13,15-dione (PubChem CID 162802210) has the molecular formula C42H50N2O4 and a molecular weight of 646.87 g/mol. Its IUPAC name is (1R,4S,16R,18S,20S)-20-[(2-amino-4-pyridinyl)methyl]-7-hydroxy-8-methoxy-4-phenyl-18-(1-propylcyclopentyl)tricyclo[14.5.0.05,10]henicosa-5,7,9-trien-2-yne-13,15-dione.
| Compound Name | (1R,4S,16R,18S,20S)-20-[(2-amino-4-pyridinyl)methyl]-7-hydroxy-8-methoxy-4-phenyl-18-(1-propylcyclopentyl)tricyclo[14.5.0.05,10]henicosa-5,7,9-trien-2-yne-13,15-dione |
|---|---|
| PubChem CID | 162802210 |
| Molecular Formula | C42H50N2O4 |
| Molecular Weight | 646.87 g/mol |
| Exact Mass | 646.38 |
| IUPAC Name | (1R,4S,16R,18S,20S)-20-[(2-amino-4-pyridinyl)methyl]-7-hydroxy-8-methoxy-4-phenyl-18-(1-propylcyclopentyl)tricyclo[14.5.0.05,10]henicosa-5,7,9-trien-2-yne-13,15-dione |
| SMILES | CCCC1([C@H]2C[C@H](Cc3ccnc(N)c3)C[C@H]3C#C[C@H](c4ccccc4)c4cc(O)c(OC)cc4CCC(=O)CC(=O)[C@@H]3C2)CCCC1 |
| InChI | InChI=1S/C42H50N2O4/c1-3-16-42(17-7-8-18-42)33-22-29(20-28-15-19-44-41(43)23-28)21-31-12-14-35(30-9-5-4-6-10-30)36-27-39(47)40(48-2)24-32(36)11-13-34(45)26-38(46)37(31)25-33/h4-6,9-10,15,19,23-24,27,29,31,33,35,37,47H,3,7-8,11,13,16-18,20-22,25-26H2,1-2H3,(H2,43,44)/t29-,31-,33+,35-,37-/m1/s1 |
| InChIKey | TVNQDYBAKFGSDH-KOPMWOEBSA-N |
| XLogP | 8.24 |
| TPSA | 102.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.87 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|