C32H44N2O9 — CID 162802771
[(1R,2R,3S,4S,5R,6R,8R,9S,10R,13R,16R,17R)-11-ethyl-3,8-dihydroxy-4,6,16-trimethoxy-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-13-yl] 2-(acetyloxyamino)benzoate (PubChem CID 162802771) has the molecular formula C32H44N2O9 and a molecular weight of 600.71 g/mol. Its IUPAC name is [(1R,2R,3S,4S,5R,6R,8R,9S,10R,13R,16R,17R)-11-ethyl-3,8-dihydroxy-4,6,16-trimethoxy-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-13-yl] 2-(acetyloxyamino)benzoate.
| Compound Name | [(1R,2R,3S,4S,5R,6R,8R,9S,10R,13R,16R,17R)-11-ethyl-3,8-dihydroxy-4,6,16-trimethoxy-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-13-yl] 2-(acetyloxyamino)benzoate |
|---|---|
| PubChem CID | 162802771 |
| Molecular Formula | C32H44N2O9 |
| Molecular Weight | 600.71 g/mol |
| Exact Mass | 600.30 |
| IUPAC Name | [(1R,2R,3S,4S,5R,6R,8R,9S,10R,13R,16R,17R)-11-ethyl-3,8-dihydroxy-4,6,16-trimethoxy-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-13-yl] 2-(acetyloxyamino)benzoate |
| SMILES | CCN1C[C@@]2(OC(=O)c3ccccc3NOC(C)=O)CC[C@@H](OC)[C@]34[C@H]5C[C@@H]6[C@H](OC)C[C@@](O)([C@@H](C[C@@H]23)[C@@H]14)[C@@]5(O)[C@H]6OC |
| InChI | InChI=1S/C32H44N2O9/c1-6-34-16-29(42-28(36)18-9-7-8-10-21(18)33-43-17(2)35)12-11-25(40-4)31-23(29)14-20(26(31)34)30(37)15-22(39-3)19-13-24(31)32(30,38)27(19)41-5/h7-10,19-20,22-27,33,37-38H,6,11-16H2,1-5H3/t19-,20+,22-,23+,24-,25-,26-,27+,29+,30-,31-,32+/m1/s1 |
| InChIKey | ILNXJLNWARWHMD-LZKYYERZSA-N |
| XLogP | 2.15 |
| TPSA | 136.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.71 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|