C29H43NO13 — CID 162805056
5-[2-[3-(cyclopentylidenemethyl)-5-methoxycarbonyl-2-[3,4,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,4-dihydro-2H-pyran-4-yl]ethenyl]-1-(2-hydroxyethyl)piperidine-3-carboxylic acid (PubChem CID 162805056) has the molecular formula C29H43NO13 and a molecular weight of 613.66 g/mol. Its IUPAC name is 5-[2-[3-(cyclopentylidenemethyl)-5-methoxycarbonyl-2-[3,4,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,4-dihydro-2H-pyran-4-yl]ethenyl]-1-(2-hydroxyethyl)piperidine-3-carboxylic acid.
| Compound Name | 5-[2-[3-(cyclopentylidenemethyl)-5-methoxycarbonyl-2-[3,4,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,4-dihydro-2H-pyran-4-yl]ethenyl]-1-(2-hydroxyethyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 162805056 |
| Molecular Formula | C29H43NO13 |
| Molecular Weight | 613.66 g/mol |
| Exact Mass | 613.27 |
| IUPAC Name | 5-[2-[3-(cyclopentylidenemethyl)-5-methoxycarbonyl-2-[3,4,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,4-dihydro-2H-pyran-4-yl]ethenyl]-1-(2-hydroxyethyl)piperidine-3-carboxylic acid |
| SMILES | COC(=O)C1=COC(OC2OC(CO)C(O)C(O)(O)C2O)C(C=C2CCCC2)C1C=CC1CC(C(=O)O)CN(CCO)C1 |
| InChI | InChI=1S/C29H43NO13/c1-40-26(37)21-15-41-27(43-28-24(34)29(38,39)23(33)22(14-32)42-28)20(11-16-4-2-3-5-16)19(21)7-6-17-10-18(25(35)36)13-30(12-17)8-9-31/h6-7,11,15,17-20,22-24,27-28,31-34,38-39H,2-5,8-10,12-14H2,1H3,(H,35,36) |
| InChIKey | NSVGXJGUITVQEJ-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 215.91 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.66 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|