C17H18N2O — CID 162805266
(3R)-3,7,8-trimethyl-1,5-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-7,9(16),10,12,14-pentaen-6-one (PubChem CID 162805266) has the molecular formula C17H18N2O and a molecular weight of 266.34 g/mol. Its IUPAC name is (3R)-3,7,8-trimethyl-1,5-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-7,9(16),10,12,14-pentaen-6-one.
| Compound Name | (3R)-3,7,8-trimethyl-1,5-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-7,9(16),10,12,14-pentaen-6-one |
|---|---|
| PubChem CID | 162805266 |
| Molecular Formula | C17H18N2O |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | (3R)-3,7,8-trimethyl-1,5-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-7,9(16),10,12,14-pentaen-6-one |
| SMILES | Cc1c(C)c2c3ccccc3n3c2n(c1=O)C[C@H](C)C3 |
| InChI | InChI=1S/C17H18N2O/c1-10-8-18-14-7-5-4-6-13(14)15-11(2)12(3)17(20)19(9-10)16(15)18/h4-7,10H,8-9H2,1-3H3/t10-/m1/s1 |
| InChIKey | OVGUAMNGMJKZCH-SNVBAGLBSA-N |
| XLogP | 3.22 |
| TPSA | 26.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |