C20H25FN4O4S — CID 162805439
1-[(3aS,4R,6R,7R,7aR)-3-(4-fluorophenyl)-6,7-dihydroxy-2-sulfanylidene-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carbonyl]piperidine-4-carboxamide (PubChem CID 162805439) has the molecular formula C20H25FN4O4S and a molecular weight of 436.51 g/mol. Its IUPAC name is 1-[(3aS,4R,6R,7R,7aR)-3-(4-fluorophenyl)-6,7-dihydroxy-2-sulfanylidene-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carbonyl]piperidine-4-carboxamide.
| Compound Name | 1-[(3aS,4R,6R,7R,7aR)-3-(4-fluorophenyl)-6,7-dihydroxy-2-sulfanylidene-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carbonyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 162805439 |
| Molecular Formula | C20H25FN4O4S |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | 1-[(3aS,4R,6R,7R,7aR)-3-(4-fluorophenyl)-6,7-dihydroxy-2-sulfanylidene-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carbonyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(C(=O)[C@@H]2C[C@@H](O)[C@H](O)[C@@H]3NC(=S)N(c4ccc(F)cc4)[C@H]32)CC1 |
| InChI | InChI=1S/C20H25FN4O4S/c21-11-1-3-12(4-2-11)25-16-13(9-14(26)17(27)15(16)23-20(25)30)19(29)24-7-5-10(6-8-24)18(22)28/h1-4,10,13-17,26-27H,5-9H2,(H2,22,28)(H,23,30)/t13-,14-,15-,16+,17+/m1/s1 |
| InChIKey | SXQGJEBNRITFMP-MTSZKFMLSA-N |
| XLogP | -0.28 |
| TPSA | 119.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|