C31H29N3O12 — CID 162806548
4-[(diaminomethylideneamino)methyl]-6-[5,6-dihydroxy-2-[4-hydroxy-2-(2-phenylethenyl)phenyl]-4-oxochromen-7-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 162806548) has the molecular formula C31H29N3O12 and a molecular weight of 635.58 g/mol. Its IUPAC name is 4-[(diaminomethylideneamino)methyl]-6-[5,6-dihydroxy-2-[4-hydroxy-2-(2-phenylethenyl)phenyl]-4-oxochromen-7-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | 4-[(diaminomethylideneamino)methyl]-6-[5,6-dihydroxy-2-[4-hydroxy-2-(2-phenylethenyl)phenyl]-4-oxochromen-7-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 162806548 |
| Molecular Formula | C31H29N3O12 |
| Molecular Weight | 635.58 g/mol |
| Exact Mass | 635.18 |
| IUPAC Name | 4-[(diaminomethylideneamino)methyl]-6-[5,6-dihydroxy-2-[4-hydroxy-2-(2-phenylethenyl)phenyl]-4-oxochromen-7-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | NC(N)=NCC1(O)C(O)C(Oc2cc3oc(-c4ccc(O)cc4C=Cc4ccccc4)cc(=O)c3c(O)c2O)OC(C(=O)O)C1O |
| InChI | InChI=1S/C31H29N3O12/c32-30(33)34-13-31(43)26(39)25(28(41)42)46-29(27(31)40)45-21-12-20-22(24(38)23(21)37)18(36)11-19(44-20)17-9-8-16(35)10-15(17)7-6-14-4-2-1-3-5-14/h1-12,25-27,29,35,37-40,43H,13H2,(H,41,42)(H4,32,33,34) |
| InChIKey | RHNMZJIQHUBHDI-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 271.75 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.58 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|