C37H32O12 — CID 162806752
5,7-dihydroxy-3-[(2S,3R,4R,5R,6R)-4-hydroxy-3,5-bis[2-(4-hydroxyphenyl)ethenoxy]-6-methyloxan-2-yl]oxy-2-(4-hydroxyphenyl)chromen-4-one (PubChem CID 162806752) has the molecular formula C37H32O12 and a molecular weight of 668.65 g/mol. Its IUPAC name is 5,7-dihydroxy-3-[(2S,3R,4R,5R,6R)-4-hydroxy-3,5-bis[2-(4-hydroxyphenyl)ethenoxy]-6-methyloxan-2-yl]oxy-2-(4-hydroxyphenyl)chromen-4-one.
| Compound Name | 5,7-dihydroxy-3-[(2S,3R,4R,5R,6R)-4-hydroxy-3,5-bis[2-(4-hydroxyphenyl)ethenoxy]-6-methyloxan-2-yl]oxy-2-(4-hydroxyphenyl)chromen-4-one |
|---|---|
| PubChem CID | 162806752 |
| Molecular Formula | C37H32O12 |
| Molecular Weight | 668.65 g/mol |
| Exact Mass | 668.19 |
| IUPAC Name | 5,7-dihydroxy-3-[(2S,3R,4R,5R,6R)-4-hydroxy-3,5-bis[2-(4-hydroxyphenyl)ethenoxy]-6-methyloxan-2-yl]oxy-2-(4-hydroxyphenyl)chromen-4-one |
| SMILES | C[C@H]1O[C@@H](Oc2c(-c3ccc(O)cc3)oc3cc(O)cc(O)c3c2=O)[C@H](OC=Cc2ccc(O)cc2)[C@H](O)[C@H]1OC=Cc1ccc(O)cc1 |
| InChI | InChI=1S/C37H32O12/c1-20-33(45-16-14-21-2-8-24(38)9-3-21)32(44)36(46-17-15-22-4-10-25(39)11-5-22)37(47-20)49-35-31(43)30-28(42)18-27(41)19-29(30)48-34(35)23-6-12-26(40)13-7-23/h2-20,32-33,36-42,44H,1H3/t20-,32-,33+,36-,37+/m1/s1 |
| InChIKey | GJTSIAVWFVRQMF-PADRUJAGSA-N |
| XLogP | 5.58 |
| TPSA | 188.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.65 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|