C20H32O6 — CID 162806947
(1S,2S,6S,8S,10S,13R,14R,16R)-2,6,8,14,16-pentahydroxy-5,5,14-trimethyl-9-methylidenetricyclo[11.2.1.01,10]hexadecan-4-one (PubChem CID 162806947) has the molecular formula C20H32O6 and a molecular weight of 368.47 g/mol. Its IUPAC name is (1S,2S,6S,8S,10S,13R,14R,16R)-2,6,8,14,16-pentahydroxy-5,5,14-trimethyl-9-methylidenetricyclo[11.2.1.01,10]hexadecan-4-one.
| Compound Name | (1S,2S,6S,8S,10S,13R,14R,16R)-2,6,8,14,16-pentahydroxy-5,5,14-trimethyl-9-methylidenetricyclo[11.2.1.01,10]hexadecan-4-one |
|---|---|
| PubChem CID | 162806947 |
| Molecular Formula | C20H32O6 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | (1S,2S,6S,8S,10S,13R,14R,16R)-2,6,8,14,16-pentahydroxy-5,5,14-trimethyl-9-methylidenetricyclo[11.2.1.01,10]hexadecan-4-one |
| SMILES | C=C1[C@@H](O)C[C@H](O)C(C)(C)C(=O)C[C@H](O)[C@]23C[C@@](C)(O)[C@H](CC[C@@H]12)[C@H]3O |
| InChI | InChI=1S/C20H32O6/c1-10-11-5-6-12-17(25)20(11,9-19(12,4)26)16(24)8-15(23)18(2,3)14(22)7-13(10)21/h11-14,16-17,21-22,24-26H,1,5-9H2,2-4H3/t11-,12+,13-,14-,16-,17+,19+,20-/m0/s1 |
| InChIKey | PMCJDBZKVUFNSX-QDIFGSJWSA-N |
| XLogP | 0.54 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|