C29H36O4 — CID 162807003
(1S,2R,3R,6S,7S,8R,11R,14R,15R,19R)-2-hydroxy-14-[(2-hydroxyphenyl)methyl]-3-methoxy-19-methylhexacyclo[9.7.1.11,8.02,6.07,19.011,15]icos-16-en-5-one (PubChem CID 162807003) has the molecular formula C29H36O4 and a molecular weight of 448.60 g/mol. Its IUPAC name is (1S,2R,3R,6S,7S,8R,11R,14R,15R,19R)-2-hydroxy-14-[(2-hydroxyphenyl)methyl]-3-methoxy-19-methylhexacyclo[9.7.1.11,8.02,6.07,19.011,15]icos-16-en-5-one.
| Compound Name | (1S,2R,3R,6S,7S,8R,11R,14R,15R,19R)-2-hydroxy-14-[(2-hydroxyphenyl)methyl]-3-methoxy-19-methylhexacyclo[9.7.1.11,8.02,6.07,19.011,15]icos-16-en-5-one |
|---|---|
| PubChem CID | 162807003 |
| Molecular Formula | C29H36O4 |
| Molecular Weight | 448.60 g/mol |
| Exact Mass | 448.26 |
| IUPAC Name | (1S,2R,3R,6S,7S,8R,11R,14R,15R,19R)-2-hydroxy-14-[(2-hydroxyphenyl)methyl]-3-methoxy-19-methylhexacyclo[9.7.1.11,8.02,6.07,19.011,15]icos-16-en-5-one |
| SMILES | CO[C@@H]1CC(=O)[C@H]2[C@@H]3[C@@H]4CC[C@]56CC[C@H](Cc7ccccc7O)[C@@H]5C=CC[C@@](C4)([C@@]12O)[C@]36C |
| InChI | InChI=1S/C29H36O4/c1-26-24-19-10-13-27(26)12-9-17(14-18-6-3-4-8-21(18)30)20(27)7-5-11-28(26,16-19)29(32)23(33-2)15-22(31)25(24)29/h3-8,17,19-20,23-25,30,32H,9-16H2,1-2H3/t17-,19-,20+,23-,24+,25+,26-,27-,28+,29-/m1/s1 |
| InChIKey | JUEWPUQGNLHJDO-BQZDCOFUSA-N |
| XLogP | 4.68 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.60 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|