C19H33N3O3 — CID 162807894
6-hydroxy-4-[(4-piperidin-2-ylpiperazin-1-yl)methyl]-3,4,4a,5,6,7,8,8a-octahydrochromen-2-one (PubChem CID 162807894) has the molecular formula C19H33N3O3 and a molecular weight of 351.49 g/mol. Its IUPAC name is 6-hydroxy-4-[(4-piperidin-2-ylpiperazin-1-yl)methyl]-3,4,4a,5,6,7,8,8a-octahydrochromen-2-one.
| Compound Name | 6-hydroxy-4-[(4-piperidin-2-ylpiperazin-1-yl)methyl]-3,4,4a,5,6,7,8,8a-octahydrochromen-2-one |
|---|---|
| PubChem CID | 162807894 |
| Molecular Formula | C19H33N3O3 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.25 |
| IUPAC Name | 6-hydroxy-4-[(4-piperidin-2-ylpiperazin-1-yl)methyl]-3,4,4a,5,6,7,8,8a-octahydrochromen-2-one |
| SMILES | O=C1CC(CN2CCN(C3CCCCN3)CC2)C2CC(O)CCC2O1 |
| InChI | InChI=1S/C19H33N3O3/c23-15-4-5-17-16(12-15)14(11-19(24)25-17)13-21-7-9-22(10-8-21)18-3-1-2-6-20-18/h14-18,20,23H,1-13H2 |
| InChIKey | KVJIGTDZGVBHRX-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |