C35H44N5O2- — CID 162808660
[3-(2-amino-1,4,5,6-tetrahydropyrimidin-6-yl)-4-carboxy-1-(1-octyl-1,2-dihydroanthracen-2-yl)but-3-en-2-yl]-(1H-pyrrol-2-yl)azanide (PubChem CID 162808660) has the molecular formula C35H44N5O2- and a molecular weight of 566.77 g/mol. Its IUPAC name is [3-(2-amino-1,4,5,6-tetrahydropyrimidin-6-yl)-4-carboxy-1-(1-octyl-1,2-dihydroanthracen-2-yl)but-3-en-2-yl]-(1H-pyrrol-2-yl)azanide.
| Compound Name | [3-(2-amino-1,4,5,6-tetrahydropyrimidin-6-yl)-4-carboxy-1-(1-octyl-1,2-dihydroanthracen-2-yl)but-3-en-2-yl]-(1H-pyrrol-2-yl)azanide |
|---|---|
| PubChem CID | 162808660 |
| Molecular Formula | C35H44N5O2- |
| Molecular Weight | 566.77 g/mol |
| Exact Mass | 566.35 |
| IUPAC Name | [3-(2-amino-1,4,5,6-tetrahydropyrimidin-6-yl)-4-carboxy-1-(1-octyl-1,2-dihydroanthracen-2-yl)but-3-en-2-yl]-(1H-pyrrol-2-yl)azanide |
| SMILES | CCCCCCCCC1c2cc3ccccc3cc2C=CC1CC([N-]c1ccc[nH]1)C(=CC(=O)O)C1CCN=C(N)N1 |
| InChI | InChI=1S/C35H44N5O2/c1-2-3-4-5-6-7-13-28-27(16-15-26-20-24-11-8-9-12-25(24)21-29(26)28)22-32(39-33-14-10-18-37-33)30(23-34(41)42)31-17-19-38-35(36)40-31/h8-12,14-16,18,20-21,23,27-28,31-32,37H,2-7,13,17,19,22H2,1H3,(H,41,42)(H3,36,38,40)/q-1 |
| InChIKey | NRJZOGGLTKIPKN-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 117.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.77 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|