C42H71O10P — CID 162809088
[(2R)-1-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-3-octadeca-9,12,15-trienoyloxypropan-2-yl] octadeca-6,9,12-trienoate (PubChem CID 162809088) has the molecular formula C42H71O10P and a molecular weight of 766.99 g/mol. Its IUPAC name is [(2R)-1-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-3-octadeca-9,12,15-trienoyloxypropan-2-yl] octadeca-6,9,12-trienoate.
| Compound Name | [(2R)-1-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-3-octadeca-9,12,15-trienoyloxypropan-2-yl] octadeca-6,9,12-trienoate |
|---|---|
| PubChem CID | 162809088 |
| Molecular Formula | C42H71O10P |
| Molecular Weight | 766.99 g/mol |
| Exact Mass | 766.48 |
| IUPAC Name | [(2R)-1-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-3-octadeca-9,12,15-trienoyloxypropan-2-yl] octadeca-6,9,12-trienoate |
| SMILES | CCC=CCC=CCC=CCCCCCCCC(=O)OC[C@H](COP(=O)(O)OC[C@@H](O)CO)OC(=O)CCCCC=CCC=CCC=CCCCCC |
| InChI | InChI=1S/C42H71O10P/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-41(45)49-37-40(38-51-53(47,48)50-36-39(44)35-43)52-42(46)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h5,7,11-14,17-20,24,26,39-40,43-44H,3-4,6,8-10,15-16,21-23,25,27-38H2,1-2H3,(H,47,48)/t39-,40+/m0/s1 |
| InChIKey | NRMAAXFTMGOMBX-IOLBBIBUSA-N |
| XLogP | 10.11 |
| TPSA | 148.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.99 |
| LogP ≤ 5 | 10.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|