C26H39N3O3 — CID 162810111
N-[(1R,2S,4aR,7R,8S,8aS)-8-hydroxy-1,4a-dimethyl-7-[(2S)-1-oxo-1-piperidin-1-ylpropan-2-yl]-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]pyridine-2-carboxamide (PubChem CID 162810111) has the molecular formula C26H39N3O3 and a molecular weight of 441.62 g/mol. Its IUPAC name is N-[(1R,2S,4aR,7R,8S,8aS)-8-hydroxy-1,4a-dimethyl-7-[(2S)-1-oxo-1-piperidin-1-ylpropan-2-yl]-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]pyridine-2-carboxamide.
| Compound Name | N-[(1R,2S,4aR,7R,8S,8aS)-8-hydroxy-1,4a-dimethyl-7-[(2S)-1-oxo-1-piperidin-1-ylpropan-2-yl]-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 162810111 |
| Molecular Formula | C26H39N3O3 |
| Molecular Weight | 441.62 g/mol |
| Exact Mass | 441.30 |
| IUPAC Name | N-[(1R,2S,4aR,7R,8S,8aS)-8-hydroxy-1,4a-dimethyl-7-[(2S)-1-oxo-1-piperidin-1-ylpropan-2-yl]-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]pyridine-2-carboxamide |
| SMILES | C[C@@H]1[C@@H]2[C@@H](O)[C@@H]([C@H](C)C(=O)N3CCCCC3)CC[C@]2(C)CC[C@@H]1NC(=O)c1ccccn1 |
| InChI | InChI=1S/C26H39N3O3/c1-17(25(32)29-15-7-4-8-16-29)19-10-12-26(3)13-11-20(18(2)22(26)23(19)30)28-24(31)21-9-5-6-14-27-21/h5-6,9,14,17-20,22-23,30H,4,7-8,10-13,15-16H2,1-3H3,(H,28,31)/t17-,18-,19+,20-,22+,23-,26+/m0/s1 |
| InChIKey | LUWNCOZCVGMMHG-VHCGLARWSA-N |
| XLogP | 3.65 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.62 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |