C15H23NO6 — CID 162810192
4-[2-hydroxy-3-(2-hydroxy-4-methyl-5-methylideneoxolan-2-yl)-3-methoxypropyl]piperidine-2,6-dione (PubChem CID 162810192) has the molecular formula C15H23NO6 and a molecular weight of 313.35 g/mol. Its IUPAC name is 4-[2-hydroxy-3-(2-hydroxy-4-methyl-5-methylideneoxolan-2-yl)-3-methoxypropyl]piperidine-2,6-dione.
| Compound Name | 4-[2-hydroxy-3-(2-hydroxy-4-methyl-5-methylideneoxolan-2-yl)-3-methoxypropyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 162810192 |
| Molecular Formula | C15H23NO6 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 4-[2-hydroxy-3-(2-hydroxy-4-methyl-5-methylideneoxolan-2-yl)-3-methoxypropyl]piperidine-2,6-dione |
| SMILES | C=C1OC(O)(C(OC)C(O)CC2CC(=O)NC(=O)C2)CC1C |
| InChI | InChI=1S/C15H23NO6/c1-8-7-15(20,22-9(8)2)14(21-3)11(17)4-10-5-12(18)16-13(19)6-10/h8,10-11,14,17,20H,2,4-7H2,1,3H3,(H,16,18,19) |
| InChIKey | TUZYQLKSYZCKIA-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|