C43H64O5 — CID 162810689
[(2S)-1-hydroxy-3-octadeca-6,9,12,15-tetraenoyloxypropan-2-yl] docosa-4,7,10,13,16,19-hexaenoate (PubChem CID 162810689) has the molecular formula C43H64O5 and a molecular weight of 660.98 g/mol. Its IUPAC name is [(2S)-1-hydroxy-3-octadeca-6,9,12,15-tetraenoyloxypropan-2-yl] docosa-4,7,10,13,16,19-hexaenoate.
| Compound Name | [(2S)-1-hydroxy-3-octadeca-6,9,12,15-tetraenoyloxypropan-2-yl] docosa-4,7,10,13,16,19-hexaenoate |
|---|---|
| PubChem CID | 162810689 |
| Molecular Formula | C43H64O5 |
| Molecular Weight | 660.98 g/mol |
| Exact Mass | 660.48 |
| IUPAC Name | [(2S)-1-hydroxy-3-octadeca-6,9,12,15-tetraenoyloxypropan-2-yl] docosa-4,7,10,13,16,19-hexaenoate |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)O[C@@H](CO)COC(=O)CCCCC=CCC=CCC=CCC=CCC |
| InChI | InChI=1S/C43H64O5/c1-3-5-7-9-11-13-15-17-19-20-21-22-24-26-28-30-32-34-36-38-43(46)48-41(39-44)40-47-42(45)37-35-33-31-29-27-25-23-18-16-14-12-10-8-6-4-2/h5-8,11-14,17-19,21-23,26-29,32,34,41,44H,3-4,9-10,15-16,20,24-25,30-31,33,35-40H2,1-2H3/t41-/m0/s1 |
| InChIKey | DPABDECPOHTCEX-RWYGWLOXSA-N |
| XLogP | 11.28 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.98 |
| LogP ≤ 5 | 11.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|