C25H26N6O4S — CID 162810816
N-[(3R,3aR,6S,6aS)-3-[[4-[4-(dimethylamino)phenyl]pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-2-cyanobenzenesulfonamide (PubChem CID 162810816) has the molecular formula C25H26N6O4S and a molecular weight of 506.59 g/mol. Its IUPAC name is N-[(3R,3aR,6S,6aS)-3-[[4-[4-(dimethylamino)phenyl]pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-2-cyanobenzenesulfonamide.
| Compound Name | N-[(3R,3aR,6S,6aS)-3-[[4-[4-(dimethylamino)phenyl]pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-2-cyanobenzenesulfonamide |
|---|---|
| PubChem CID | 162810816 |
| Molecular Formula | C25H26N6O4S |
| Molecular Weight | 506.59 g/mol |
| Exact Mass | 506.17 |
| IUPAC Name | N-[(3R,3aR,6S,6aS)-3-[[4-[4-(dimethylamino)phenyl]pyrimidin-2-yl]amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-2-cyanobenzenesulfonamide |
| SMILES | CN(C)c1ccc(-c2ccnc(N[C@@H]3CO[C@@H]4[C@@H]3OC[C@@H]4NS(=O)(=O)c3ccccc3C#N)n2)cc1 |
| InChI | InChI=1S/C25H26N6O4S/c1-31(2)18-9-7-16(8-10-18)19-11-12-27-25(28-19)29-20-14-34-24-21(15-35-23(20)24)30-36(32,33)22-6-4-3-5-17(22)13-26/h3-12,20-21,23-24,30H,14-15H2,1-2H3,(H,27,28,29)/t20-,21+,23-,24+/m1/s1 |
| InChIKey | LOOFYTUJWWDWRP-JSRBNTPPSA-N |
| XLogP | 2.01 |
| TPSA | 129.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.59 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |