C20H26O8 — CID 162810936
(1R,2E,5R,7S,10R,11S,14R)-2-ethylidene-14-hydroxy-10-(methoxymethyl)-5,14-dimethyl-4,8,17-trioxatetracyclo[9.5.1.01,5.07,11]heptadecane-3,9,12-trione (PubChem CID 162810936) has the molecular formula C20H26O8 and a molecular weight of 394.42 g/mol. Its IUPAC name is (1R,2E,5R,7S,10R,11S,14R)-2-ethylidene-14-hydroxy-10-(methoxymethyl)-5,14-dimethyl-4,8,17-trioxatetracyclo[9.5.1.01,5.07,11]heptadecane-3,9,12-trione.
| Compound Name | (1R,2E,5R,7S,10R,11S,14R)-2-ethylidene-14-hydroxy-10-(methoxymethyl)-5,14-dimethyl-4,8,17-trioxatetracyclo[9.5.1.01,5.07,11]heptadecane-3,9,12-trione |
|---|---|
| PubChem CID | 162810936 |
| Molecular Formula | C20H26O8 |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | (1R,2E,5R,7S,10R,11S,14R)-2-ethylidene-14-hydroxy-10-(methoxymethyl)-5,14-dimethyl-4,8,17-trioxatetracyclo[9.5.1.01,5.07,11]heptadecane-3,9,12-trione |
| SMILES | C/C=C1/C(=O)O[C@]2(C)C[C@@H]3OC(=O)[C@H](COC)[C@]34O[C@]12CC[C@@](C)(O)CC4=O |
| InChI | InChI=1S/C20H26O8/c1-5-11-16(23)27-18(3)9-14-20(12(10-25-4)15(22)26-14)13(21)8-17(2,24)6-7-19(11,18)28-20/h5,12,14,24H,6-10H2,1-4H3/b11-5-/t12-,14-,17+,18+,19+,20+/m0/s1 |
| InChIKey | QVGLHAFVKXAJTP-TVCFHZJYSA-N |
| XLogP | 0.84 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|