About [3-[[3-(dimethylamino)-2,2-dimethylcyclobutyl]methyl]-1,2-oxazol-5-yl]methanol
[3-[[3-(dimethylamino)-2,2-dimethylcyclobutyl]methyl]-1,2-oxazol-5-yl]methanol (PubChem CID 162811147) has the molecular formula C13H22N2O2
and a molecular weight of 238.33 g/mol. Its IUPAC name is [3-[[3-(dimethylamino)-2,2-dimethylcyclobutyl]methyl]-1,2-oxazol-5-yl]methanol.
Molecular Properties
| Compound Name | [3-[[3-(dimethylamino)-2,2-dimethylcyclobutyl]methyl]-1,2-oxazol-5-yl]methanol |
| PubChem CID | 162811147 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | [3-[[3-(dimethylamino)-2,2-dimethylcyclobutyl]methyl]-1,2-oxazol-5-yl]methanol |
| SMILES | CN(C)C1CC(Cc2cc(CO)on2)C1(C)C |
| InChI | InChI=1S/C13H22N2O2/c1-13(2)9(6-12(13)15(3)4)5-10-7-11(8-16)17-14-10/h7,9,12,16H,5-6,8H2,1-4H3 |
| InChIKey | DLDLWOWCOKBCLN-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 49.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-[[3-(dimethylamino)-2,2-dimethylcyclobutyl]methyl]-1,2-oxazol-5-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[[3-(dimethylamino)-2,2-dimethylcyclobutyl]methyl]-1,2-oxazol-5-yl]methanol?
The IUPAC name of [3-[[3-(dimethylamino)-2,2-dimethylcyclobutyl]methyl]-1,2-oxazol-5-yl]methanol (CID 162811147) is [3-[[3-(dimethylamino)-2,2-dimethylcyclobutyl]methyl]-1,2-oxazol-5-yl]methanol.
What is the SMILES notation for [3-[[3-(dimethylamino)-2,2-dimethylcyclobutyl]methyl]-1,2-oxazol-5-yl]methanol?
The canonical SMILES for [3-[[3-(dimethylamino)-2,2-dimethylcyclobutyl]methyl]-1,2-oxazol-5-yl]methanol is CN(C)C1CC(Cc2cc(CO)on2)C1(C)C.
What is the InChIKey of [3-[[3-(dimethylamino)-2,2-dimethylcyclobutyl]methyl]-1,2-oxazol-5-yl]methanol?
The InChIKey is DLDLWOWCOKBCLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2O2/c1-13(2)9(6-12(13)15(3)4)5-10-7-11(8-16)17-14-10/h7,9,12,16H,5-6,8H2,1-4H3.
What are the key properties of [3-[[3-(dimethylamino)-2,2-dimethylcyclobutyl]methyl]-1,2-oxazol-5-yl]methanol?
[3-[[3-(dimethylamino)-2,2-dimethylcyclobutyl]methyl]-1,2-oxazol-5-yl]methanol has a molecular weight of 238.33 g/mol, XLogP of 1.69, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[[3-(dimethylamino)-2,2-dimethylcyclobutyl]methyl]-1,2-oxazol-5-yl]methanol is sourced from PubChem (CID 162811147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).