C46H61NO2 — CID 162811577
2-[(1R,2R,7S,11S,13R,15R,16S,17R)-16-(2-aminoethyl)-13-[(Z)-5-cyclohexylpent-2-enyl]-2,11-diphenyl-17-tricyclo[13.2.2.02,7]nonadec-18-en-8-ynyl]acetic acid (PubChem CID 162811577) has the molecular formula C46H61NO2 and a molecular weight of 660.00 g/mol. Its IUPAC name is 2-[(1R,2R,7S,11S,13R,15R,16S,17R)-16-(2-aminoethyl)-13-[(Z)-5-cyclohexylpent-2-enyl]-2,11-diphenyl-17-tricyclo[13.2.2.02,7]nonadec-18-en-8-ynyl]acetic acid.
| Compound Name | 2-[(1R,2R,7S,11S,13R,15R,16S,17R)-16-(2-aminoethyl)-13-[(Z)-5-cyclohexylpent-2-enyl]-2,11-diphenyl-17-tricyclo[13.2.2.02,7]nonadec-18-en-8-ynyl]acetic acid |
|---|---|
| PubChem CID | 162811577 |
| Molecular Formula | C46H61NO2 |
| Molecular Weight | 660.00 g/mol |
| Exact Mass | 659.47 |
| IUPAC Name | 2-[(1R,2R,7S,11S,13R,15R,16S,17R)-16-(2-aminoethyl)-13-[(Z)-5-cyclohexylpent-2-enyl]-2,11-diphenyl-17-tricyclo[13.2.2.02,7]nonadec-18-en-8-ynyl]acetic acid |
| SMILES | NCC[C@@H]1[C@@H](CC(=O)O)[C@H]2C=C[C@H]1C[C@@H](C/C=C\CCC1CCCCC1)C[C@H](c1ccccc1)CC#C[C@@H]1CCCC[C@]12c1ccccc1 |
| InChI | InChI=1S/C46H61NO2/c47-31-29-42-39-27-28-44(43(42)34-45(48)49)46(40-23-11-4-12-24-40)30-14-13-25-41(46)26-15-22-38(37-20-9-3-10-21-37)32-36(33-39)19-8-2-7-18-35-16-5-1-6-17-35/h2-4,8-12,20-21,23-24,27-28,35-36,38-39,41-44H,1,5-7,13-14,16-19,22,25,29-34,47H2,(H,48,49)/b8-2-/t36-,38+,39-,41-,42-,43+,44+,46-/m0/s1 |
| InChIKey | WJESNNVXGPSUPI-CTGGACPKSA-N |
| XLogP | 10.87 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.00 |
| LogP ≤ 5 | 10.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|