C29H36O3 — CID 162813059
(1S,2R,3R,6S,7S,9S,12R,15S,16S,20R)-15-benzyl-2-hydroxy-3-methoxy-20-methylhexacyclo[10.7.1.01,9.02,6.07,20.012,16]icos-17-en-5-one (PubChem CID 162813059) has the molecular formula C29H36O3 and a molecular weight of 432.60 g/mol. Its IUPAC name is (1S,2R,3R,6S,7S,9S,12R,15S,16S,20R)-15-benzyl-2-hydroxy-3-methoxy-20-methylhexacyclo[10.7.1.01,9.02,6.07,20.012,16]icos-17-en-5-one.
| Compound Name | (1S,2R,3R,6S,7S,9S,12R,15S,16S,20R)-15-benzyl-2-hydroxy-3-methoxy-20-methylhexacyclo[10.7.1.01,9.02,6.07,20.012,16]icos-17-en-5-one |
|---|---|
| PubChem CID | 162813059 |
| Molecular Formula | C29H36O3 |
| Molecular Weight | 432.60 g/mol |
| Exact Mass | 432.27 |
| IUPAC Name | (1S,2R,3R,6S,7S,9S,12R,15S,16S,20R)-15-benzyl-2-hydroxy-3-methoxy-20-methylhexacyclo[10.7.1.01,9.02,6.07,20.012,16]icos-17-en-5-one |
| SMILES | CO[C@@H]1CC(=O)[C@H]2[C@@H]3C[C@@H]4CC[C@]56CC[C@@H](Cc7ccccc7)[C@H]5C=CC[C@@]4([C@@]12O)[C@]36C |
| InChI | InChI=1S/C29H36O3/c1-26-22-16-20-11-14-27(26)13-10-19(15-18-7-4-3-5-8-18)21(27)9-6-12-28(20,26)29(31)24(32-2)17-23(30)25(22)29/h3-9,19-22,24-25,31H,10-17H2,1-2H3/t19-,20-,21+,22-,24+,25+,26+,27+,28-,29+/m0/s1 |
| InChIKey | YPWIFSMKBIWMAP-IURNRQDISA-N |
| XLogP | 4.97 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.60 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|