C24H28O7 — CID 162813119
2-[(2S,3R)-3-(3-methylbut-2-enoyloxy)-7-oxo-2,3-dihydrofuro[3,2-g]chromen-2-yl]propan-2-yl (2S)-2-methylbutanoate (PubChem CID 162813119) has the molecular formula C24H28O7 and a molecular weight of 428.48 g/mol. Its IUPAC name is 2-[(2S,3R)-3-(3-methylbut-2-enoyloxy)-7-oxo-2,3-dihydrofuro[3,2-g]chromen-2-yl]propan-2-yl (2S)-2-methylbutanoate.
| Compound Name | 2-[(2S,3R)-3-(3-methylbut-2-enoyloxy)-7-oxo-2,3-dihydrofuro[3,2-g]chromen-2-yl]propan-2-yl (2S)-2-methylbutanoate |
|---|---|
| PubChem CID | 162813119 |
| Molecular Formula | C24H28O7 |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 2-[(2S,3R)-3-(3-methylbut-2-enoyloxy)-7-oxo-2,3-dihydrofuro[3,2-g]chromen-2-yl]propan-2-yl (2S)-2-methylbutanoate |
| SMILES | CC[C@H](C)C(=O)OC(C)(C)[C@H]1Oc2cc3oc(=O)ccc3cc2[C@H]1OC(=O)C=C(C)C |
| InChI | InChI=1S/C24H28O7/c1-7-14(4)23(27)31-24(5,6)22-21(30-20(26)10-13(2)3)16-11-15-8-9-19(25)28-17(15)12-18(16)29-22/h8-12,14,21-22H,7H2,1-6H3/t14-,21+,22-/m0/s1 |
| InChIKey | JEEYPDBUKJICPY-CUJSYCCXSA-N |
| XLogP | 4.47 |
| TPSA | 92.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|