C27H46NO3+ — CID 162813335
methyl 1,4a-dimethyl-6-methylidene-5-[2-[2-(piperidin-1-ium-1-ylmethyl)oxolan-3-yl]ethyl]-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate (PubChem CID 162813335) has the molecular formula C27H46NO3+ and a molecular weight of 432.67 g/mol. Its IUPAC name is methyl 1,4a-dimethyl-6-methylidene-5-[2-[2-(piperidin-1-ium-1-ylmethyl)oxolan-3-yl]ethyl]-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate.
| Compound Name | methyl 1,4a-dimethyl-6-methylidene-5-[2-[2-(piperidin-1-ium-1-ylmethyl)oxolan-3-yl]ethyl]-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 162813335 |
| Molecular Formula | C27H46NO3+ |
| Molecular Weight | 432.67 g/mol |
| Exact Mass | 432.35 |
| IUPAC Name | methyl 1,4a-dimethyl-6-methylidene-5-[2-[2-(piperidin-1-ium-1-ylmethyl)oxolan-3-yl]ethyl]-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate |
| SMILES | C=C1CCC2C(C)(C(=O)OC)CCCC2(C)C1CCC1CCOC1C[NH+]1CCCCC1 |
| InChI | InChI=1S/C27H45NO3/c1-20-9-12-24-26(2,14-8-15-27(24,3)25(29)30-4)22(20)11-10-21-13-18-31-23(21)19-28-16-6-5-7-17-28/h21-24H,1,5-19H2,2-4H3/p+1 |
| InChIKey | HBNHHMFKEZEFBN-UHFFFAOYSA-O |
| XLogP | 4.19 |
| TPSA | 39.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.67 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|