C24H40Cl2O4 — CID 162813356
(3R,5S,7R,8S,9S,10S,12S,13R,14S,17R)-17-[(2S)-5,5-dichloro-5-hydroxypentan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,7,12-triol (PubChem CID 162813356) has the molecular formula C24H40Cl2O4 and a molecular weight of 463.49 g/mol. Its IUPAC name is (3R,5S,7R,8S,9S,10S,12S,13R,14S,17R)-17-[(2S)-5,5-dichloro-5-hydroxypentan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,7,12-triol.
| Compound Name | (3R,5S,7R,8S,9S,10S,12S,13R,14S,17R)-17-[(2S)-5,5-dichloro-5-hydroxypentan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,7,12-triol |
|---|---|
| PubChem CID | 162813356 |
| Molecular Formula | C24H40Cl2O4 |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | (3R,5S,7R,8S,9S,10S,12S,13R,14S,17R)-17-[(2S)-5,5-dichloro-5-hydroxypentan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,7,12-triol |
| SMILES | C[C@@H](CCC(O)(Cl)Cl)[C@H]1CC[C@H]2[C@H]3[C@H](O)C[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3C[C@H](O)[C@]12C |
| InChI | InChI=1S/C24H40Cl2O4/c1-13(6-9-24(25,26)30)16-4-5-17-21-18(12-20(29)23(16,17)3)22(2)8-7-15(27)10-14(22)11-19(21)28/h13-21,27-30H,4-12H2,1-3H3/t13-,14-,15+,16+,17-,18-,19+,20-,21+,22-,23+/m0/s1 |
| InChIKey | USXNWTLURUZXKT-FBPFWDPESA-N |
| XLogP | 4.49 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|