C28H36O8 — CID 162814344
2-hex-4-enoyl-4,4a,8-trihydroxy-9-(1-hydroxyhexa-2,4-dienylidene)-4,5a,7,9b-tetramethyl-3,9a-dihydro-2H-dibenzofuran-1,6-dione (PubChem CID 162814344) has the molecular formula C28H36O8 and a molecular weight of 500.59 g/mol. Its IUPAC name is 2-hex-4-enoyl-4,4a,8-trihydroxy-9-(1-hydroxyhexa-2,4-dienylidene)-4,5a,7,9b-tetramethyl-3,9a-dihydro-2H-dibenzofuran-1,6-dione.
| Compound Name | 2-hex-4-enoyl-4,4a,8-trihydroxy-9-(1-hydroxyhexa-2,4-dienylidene)-4,5a,7,9b-tetramethyl-3,9a-dihydro-2H-dibenzofuran-1,6-dione |
|---|---|
| PubChem CID | 162814344 |
| Molecular Formula | C28H36O8 |
| Molecular Weight | 500.59 g/mol |
| Exact Mass | 500.24 |
| IUPAC Name | 2-hex-4-enoyl-4,4a,8-trihydroxy-9-(1-hydroxyhexa-2,4-dienylidene)-4,5a,7,9b-tetramethyl-3,9a-dihydro-2H-dibenzofuran-1,6-dione |
| SMILES | CC=CC=CC(O)=C1C(O)=C(C)C(=O)C2(C)OC3(O)C(C)(O)CC(C(=O)CCC=CC)C(=O)C3(C)C12 |
| InChI | InChI=1S/C28H36O8/c1-7-9-11-13-18(29)17-15-25(4,34)28(35)26(5,24(17)33)22-20(19(30)14-12-10-8-2)21(31)16(3)23(32)27(22,6)36-28/h7-10,12,14,17,22,30-31,34-35H,11,13,15H2,1-6H3 |
| InChIKey | GSJHXSBNOUHSSS-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.59 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|