About octa-2,4-diene-1,6,7-triol
octa-2,4-diene-1,6,7-triol (PubChem CID 162814534) has the molecular formula C8H14O3
and a molecular weight of 158.20 g/mol. Its IUPAC name is octa-2,4-diene-1,6,7-triol.
Molecular Properties
| Compound Name | octa-2,4-diene-1,6,7-triol |
| PubChem CID | 162814534 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | octa-2,4-diene-1,6,7-triol |
| SMILES | CC(O)C(O)C=CC=CCO |
| InChI | InChI=1S/C8H14O3/c1-7(10)8(11)5-3-2-4-6-9/h2-5,7-11H,6H2,1H3 |
| InChIKey | LSPIBEIDSFWFRY-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze octa-2,4-diene-1,6,7-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octa-2,4-diene-1,6,7-triol?
The IUPAC name of octa-2,4-diene-1,6,7-triol (CID 162814534) is octa-2,4-diene-1,6,7-triol.
What is the SMILES notation for octa-2,4-diene-1,6,7-triol?
The canonical SMILES for octa-2,4-diene-1,6,7-triol is CC(O)C(O)C=CC=CCO.
What is the InChIKey of octa-2,4-diene-1,6,7-triol?
The InChIKey is LSPIBEIDSFWFRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O3/c1-7(10)8(11)5-3-2-4-6-9/h2-5,7-11H,6H2,1H3.
What are the key properties of octa-2,4-diene-1,6,7-triol?
octa-2,4-diene-1,6,7-triol has a molecular weight of 158.20 g/mol, XLogP of -0.17, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for octa-2,4-diene-1,6,7-triol is sourced from PubChem (CID 162814534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).