C15H20O3 — CID 162814861
1,5,11,11-tetramethyl-8-oxatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-4,9-diol (PubChem CID 162814861) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is 1,5,11,11-tetramethyl-8-oxatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-4,9-diol.
| Compound Name | 1,5,11,11-tetramethyl-8-oxatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-4,9-diol |
|---|---|
| PubChem CID | 162814861 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 1,5,11,11-tetramethyl-8-oxatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-4,9-diol |
| SMILES | Cc1cc2c(cc1O)C1(C)CC(O)(CC1(C)C)O2 |
| InChI | InChI=1S/C15H20O3/c1-9-5-12-10(6-11(9)16)14(4)8-15(17,18-12)7-13(14,2)3/h5-6,16-17H,7-8H2,1-4H3 |
| InChIKey | XOUGEILHFRFJQL-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |