C25H31ClO6 — CID 162815906
11-chloro-10,15-dihydroxy-6,14,18,18,22-pentamethyl-7,13-dioxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-3,9,11-triene-8,19-dione (PubChem CID 162815906) has the molecular formula C25H31ClO6 and a molecular weight of 462.97 g/mol. Its IUPAC name is 11-chloro-10,15-dihydroxy-6,14,18,18,22-pentamethyl-7,13-dioxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-3,9,11-triene-8,19-dione.
| Compound Name | 11-chloro-10,15-dihydroxy-6,14,18,18,22-pentamethyl-7,13-dioxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-3,9,11-triene-8,19-dione |
|---|---|
| PubChem CID | 162815906 |
| Molecular Formula | C25H31ClO6 |
| Molecular Weight | 462.97 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | 11-chloro-10,15-dihydroxy-6,14,18,18,22-pentamethyl-7,13-dioxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-3,9,11-triene-8,19-dione |
| SMILES | CC1Cc2c3c(c(Cl)c(O)c2C(=O)O1)OC1(C)C(O)CC2C(C)(C)C(=O)CCC2(C)C1C3 |
| InChI | InChI=1S/C25H31ClO6/c1-11-8-12-13-9-15-24(4)7-6-16(27)23(2,3)14(24)10-17(28)25(15,5)32-21(13)19(26)20(29)18(12)22(30)31-11/h11,14-15,17,28-29H,6-10H2,1-5H3 |
| InChIKey | JNXFWWUYFSVCSO-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.97 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |