C20H34O4 — CID 162815916
14-(hydroxymethyl)-3,10-dimethyl-6-propan-2-yltricyclo[9.3.0.03,7]tetradec-7-ene-4,10,12-triol (PubChem CID 162815916) has the molecular formula C20H34O4 and a molecular weight of 338.49 g/mol. Its IUPAC name is 14-(hydroxymethyl)-3,10-dimethyl-6-propan-2-yltricyclo[9.3.0.03,7]tetradec-7-ene-4,10,12-triol.
| Compound Name | 14-(hydroxymethyl)-3,10-dimethyl-6-propan-2-yltricyclo[9.3.0.03,7]tetradec-7-ene-4,10,12-triol |
|---|---|
| PubChem CID | 162815916 |
| Molecular Formula | C20H34O4 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | 14-(hydroxymethyl)-3,10-dimethyl-6-propan-2-yltricyclo[9.3.0.03,7]tetradec-7-ene-4,10,12-triol |
| SMILES | CC(C)C1CC(O)C2(C)CC3C(CO)CC(O)C3C(C)(O)CC=C12 |
| InChI | InChI=1S/C20H34O4/c1-11(2)13-8-17(23)19(3)9-14-12(10-21)7-16(22)18(14)20(4,24)6-5-15(13)19/h5,11-14,16-18,21-24H,6-10H2,1-4H3 |
| InChIKey | KRGUNUMKPQQOQA-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|