About 3-hydroxy-2-penta-1,3-dienyl-2,3-dihydropyran-6-one
3-hydroxy-2-penta-1,3-dienyl-2,3-dihydropyran-6-one (PubChem CID 162815938) has the molecular formula C10H12O3
and a molecular weight of 180.20 g/mol. Its IUPAC name is 3-hydroxy-2-penta-1,3-dienyl-2,3-dihydropyran-6-one.
Molecular Properties
| Compound Name | 3-hydroxy-2-penta-1,3-dienyl-2,3-dihydropyran-6-one |
| PubChem CID | 162815938 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 3-hydroxy-2-penta-1,3-dienyl-2,3-dihydropyran-6-one |
| SMILES | CC=CC=CC1OC(=O)C=CC1O |
| InChI | InChI=1S/C10H12O3/c1-2-3-4-5-9-8(11)6-7-10(12)13-9/h2-9,11H,1H3 |
| InChIKey | OOQUCJPSNWQKFG-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxy-2-penta-1,3-dienyl-2,3-dihydropyran-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-2-penta-1,3-dienyl-2,3-dihydropyran-6-one?
The IUPAC name of 3-hydroxy-2-penta-1,3-dienyl-2,3-dihydropyran-6-one (CID 162815938) is 3-hydroxy-2-penta-1,3-dienyl-2,3-dihydropyran-6-one.
What is the SMILES notation for 3-hydroxy-2-penta-1,3-dienyl-2,3-dihydropyran-6-one?
The canonical SMILES for 3-hydroxy-2-penta-1,3-dienyl-2,3-dihydropyran-6-one is CC=CC=CC1OC(=O)C=CC1O.
What is the InChIKey of 3-hydroxy-2-penta-1,3-dienyl-2,3-dihydropyran-6-one?
The InChIKey is OOQUCJPSNWQKFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O3/c1-2-3-4-5-9-8(11)6-7-10(12)13-9/h2-9,11H,1H3.
What are the key properties of 3-hydroxy-2-penta-1,3-dienyl-2,3-dihydropyran-6-one?
3-hydroxy-2-penta-1,3-dienyl-2,3-dihydropyran-6-one has a molecular weight of 180.20 g/mol, XLogP of 0.96, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-2-penta-1,3-dienyl-2,3-dihydropyran-6-one is sourced from PubChem (CID 162815938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).