C10H12O3 — CID 162815938
3-hydroxy-2-penta-1,3-dienyl-2,3-dihydropyran-6-one (PubChem CID 162815938) has the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. Its IUPAC name is 3-hydroxy-2-penta-1,3-dienyl-2,3-dihydropyran-6-one.
| Compound Name | 3-hydroxy-2-penta-1,3-dienyl-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 162815938 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 3-hydroxy-2-penta-1,3-dienyl-2,3-dihydropyran-6-one |
| SMILES | CC=CC=CC1OC(=O)C=CC1O |
| InChI | InChI=1S/C10H12O3/c1-2-3-4-5-9-8(11)6-7-10(12)13-9/h2-9,11H,1H3 |
| InChIKey | OOQUCJPSNWQKFG-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|