C22H32O6 — CID 162815984
[5-methoxy-4-[2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 3-(3-methyloxiran-2-yl)prop-2-enoate (PubChem CID 162815984) has the molecular formula C22H32O6 and a molecular weight of 392.49 g/mol. Its IUPAC name is [5-methoxy-4-[2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 3-(3-methyloxiran-2-yl)prop-2-enoate.
| Compound Name | [5-methoxy-4-[2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 3-(3-methyloxiran-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 162815984 |
| Molecular Formula | C22H32O6 |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | [5-methoxy-4-[2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 3-(3-methyloxiran-2-yl)prop-2-enoate |
| SMILES | COC1C(OC(=O)C=CC2OC2C)CCC2(CO2)C1C1(C)OC1CC=C(C)C |
| InChI | InChI=1S/C22H32O6/c1-13(2)6-8-17-21(4,28-17)20-19(24-5)16(10-11-22(20)12-25-22)27-18(23)9-7-15-14(3)26-15/h6-7,9,14-17,19-20H,8,10-12H2,1-5H3 |
| InChIKey | XRHQZHUELPPLQD-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 73.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|