C16H27NO5 — CID 162816344
(1S,4R,5S)-4-hydroxy-1-[(2S)-2-hydroxy-2-methyloctanoyl]-4-propan-2-yl-6-oxa-3-azabicyclo[3.1.0]hexan-2-one (PubChem CID 162816344) has the molecular formula C16H27NO5 and a molecular weight of 313.39 g/mol. Its IUPAC name is (1S,4R,5S)-4-hydroxy-1-[(2S)-2-hydroxy-2-methyloctanoyl]-4-propan-2-yl-6-oxa-3-azabicyclo[3.1.0]hexan-2-one.
| Compound Name | (1S,4R,5S)-4-hydroxy-1-[(2S)-2-hydroxy-2-methyloctanoyl]-4-propan-2-yl-6-oxa-3-azabicyclo[3.1.0]hexan-2-one |
|---|---|
| PubChem CID | 162816344 |
| Molecular Formula | C16H27NO5 |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | (1S,4R,5S)-4-hydroxy-1-[(2S)-2-hydroxy-2-methyloctanoyl]-4-propan-2-yl-6-oxa-3-azabicyclo[3.1.0]hexan-2-one |
| SMILES | CCCCCC[C@](C)(O)C(=O)[C@@]12O[C@@H]1[C@](O)(C(C)C)NC2=O |
| InChI | InChI=1S/C16H27NO5/c1-5-6-7-8-9-14(4,20)11(18)15-12(22-15)16(21,10(2)3)17-13(15)19/h10,12,20-21H,5-9H2,1-4H3,(H,17,19)/t12-,14-,15+,16+/m0/s1 |
| InChIKey | BYUPZWWVBGDJCD-ARLBYUKCSA-N |
| XLogP | 0.89 |
| TPSA | 99.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|