C21H28O6 — CID 162816439
18,20-dihydroxy-8,8,14-trimethyl-7,9,15-trioxatricyclo[15.4.0.06,10]henicosa-1(17),2,18,20-tetraen-16-one (PubChem CID 162816439) has the molecular formula C21H28O6 and a molecular weight of 376.45 g/mol. Its IUPAC name is 18,20-dihydroxy-8,8,14-trimethyl-7,9,15-trioxatricyclo[15.4.0.06,10]henicosa-1(17),2,18,20-tetraen-16-one.
| Compound Name | 18,20-dihydroxy-8,8,14-trimethyl-7,9,15-trioxatricyclo[15.4.0.06,10]henicosa-1(17),2,18,20-tetraen-16-one |
|---|---|
| PubChem CID | 162816439 |
| Molecular Formula | C21H28O6 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 18,20-dihydroxy-8,8,14-trimethyl-7,9,15-trioxatricyclo[15.4.0.06,10]henicosa-1(17),2,18,20-tetraen-16-one |
| SMILES | CC1CCCC2OC(C)(C)OC2CCC=Cc2cc(O)cc(O)c2C(=O)O1 |
| InChI | InChI=1S/C21H28O6/c1-13-7-6-10-18-17(26-21(2,3)27-18)9-5-4-8-14-11-15(22)12-16(23)19(14)20(24)25-13/h4,8,11-13,17-18,22-23H,5-7,9-10H2,1-3H3 |
| InChIKey | YQBDPTQRQMXVTH-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |