C32H40O7 — CID 162816832
[(1R,3R,5S,6aR,7S,8R,10R,10aR)-1,3-diacetyloxy-10-hydroxy-7,8-dimethyl-7-(3-methylpenta-2,4-dienyl)-2,3,5,6,6a,8,9,10-octahydro-1H-cyclopenta[j]naphthalen-5-yl] benzoate (PubChem CID 162816832) has the molecular formula C32H40O7 and a molecular weight of 536.67 g/mol. Its IUPAC name is [(1R,3R,5S,6aR,7S,8R,10R,10aR)-1,3-diacetyloxy-10-hydroxy-7,8-dimethyl-7-(3-methylpenta-2,4-dienyl)-2,3,5,6,6a,8,9,10-octahydro-1H-cyclopenta[j]naphthalen-5-yl] benzoate.
| Compound Name | [(1R,3R,5S,6aR,7S,8R,10R,10aR)-1,3-diacetyloxy-10-hydroxy-7,8-dimethyl-7-(3-methylpenta-2,4-dienyl)-2,3,5,6,6a,8,9,10-octahydro-1H-cyclopenta[j]naphthalen-5-yl] benzoate |
|---|---|
| PubChem CID | 162816832 |
| Molecular Formula | C32H40O7 |
| Molecular Weight | 536.67 g/mol |
| Exact Mass | 536.28 |
| IUPAC Name | [(1R,3R,5S,6aR,7S,8R,10R,10aR)-1,3-diacetyloxy-10-hydroxy-7,8-dimethyl-7-(3-methylpenta-2,4-dienyl)-2,3,5,6,6a,8,9,10-octahydro-1H-cyclopenta[j]naphthalen-5-yl] benzoate |
| SMILES | C=CC(C)=CC[C@@]1(C)[C@H](C)C[C@@H](O)[C@]23C(=C[C@@H](OC(=O)c4ccccc4)C[C@H]12)[C@H](OC(C)=O)C[C@H]3OC(C)=O |
| InChI | InChI=1S/C32H40O7/c1-7-19(2)13-14-31(6)20(3)15-28(35)32-25(26(37-21(4)33)18-29(32)38-22(5)34)16-24(17-27(31)32)39-30(36)23-11-9-8-10-12-23/h7-13,16,20,24,26-29,35H,1,14-15,17-18H2,2-6H3/t20-,24-,26-,27-,28-,29-,31+,32+/m1/s1 |
| InChIKey | VTISHTZXAFABIG-RUXKCZOSSA-N |
| XLogP | 5.34 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.67 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|