C14H16O4 — CID 162816974
(1R,2S,3S,6S,10R)-3-methyl-2-[(E)-3-oxobut-1-enyl]-5-oxatricyclo[4.3.1.03,10]decane-4,7-dione (PubChem CID 162816974) has the molecular formula C14H16O4 and a molecular weight of 248.28 g/mol. Its IUPAC name is (1R,2S,3S,6S,10R)-3-methyl-2-[(E)-3-oxobut-1-enyl]-5-oxatricyclo[4.3.1.03,10]decane-4,7-dione.
| Compound Name | (1R,2S,3S,6S,10R)-3-methyl-2-[(E)-3-oxobut-1-enyl]-5-oxatricyclo[4.3.1.03,10]decane-4,7-dione |
|---|---|
| PubChem CID | 162816974 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | (1R,2S,3S,6S,10R)-3-methyl-2-[(E)-3-oxobut-1-enyl]-5-oxatricyclo[4.3.1.03,10]decane-4,7-dione |
| SMILES | CC(=O)/C=C/[C@H]1[C@H]2CCC(=O)[C@H]3OC(=O)[C@]1(C)[C@@H]23 |
| InChI | InChI=1S/C14H16O4/c1-7(15)3-5-9-8-4-6-10(16)12-11(8)14(9,2)13(17)18-12/h3,5,8-9,11-12H,4,6H2,1-2H3/b5-3+/t8-,9+,11+,12-,14+/m1/s1 |
| InChIKey | ZRZROQUVFFSYRO-VOPKFZRJSA-N |
| XLogP | 1.29 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|