C30H52O3 — CID 162817213
15-(6-hydroperoxy-6-methylheptan-2-yl)-7,7,12,16-tetramethylpentacyclo[9.7.0.01,3.03,8.012,16]octadecan-6-ol (PubChem CID 162817213) has the molecular formula C30H52O3 and a molecular weight of 460.74 g/mol. Its IUPAC name is 15-(6-hydroperoxy-6-methylheptan-2-yl)-7,7,12,16-tetramethylpentacyclo[9.7.0.01,3.03,8.012,16]octadecan-6-ol.
| Compound Name | 15-(6-hydroperoxy-6-methylheptan-2-yl)-7,7,12,16-tetramethylpentacyclo[9.7.0.01,3.03,8.012,16]octadecan-6-ol |
|---|---|
| PubChem CID | 162817213 |
| Molecular Formula | C30H52O3 |
| Molecular Weight | 460.74 g/mol |
| Exact Mass | 460.39 |
| IUPAC Name | 15-(6-hydroperoxy-6-methylheptan-2-yl)-7,7,12,16-tetramethylpentacyclo[9.7.0.01,3.03,8.012,16]octadecan-6-ol |
| SMILES | CC(CCCC(C)(C)OO)C1CCC2(C)C3CCC4C(C)(C)C(O)CCC45CC35CCC12C |
| InChI | InChI=1S/C30H52O3/c1-20(9-8-14-25(2,3)33-32)21-12-15-28(7)23-11-10-22-26(4,5)24(31)13-16-29(22)19-30(23,29)18-17-27(21,28)6/h20-24,31-32H,8-19H2,1-7H3 |
| InChIKey | TUKFJQKYIHLUEX-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.74 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|