C37H62O9 — CID 162819239
2-[[8-hydroxy-4,8a-bis(hydroxymethyl)-14-methoxy-4,6a,6b,11,11,14b-hexamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-6-methyloxane-3,4,5-triol (PubChem CID 162819239) has the molecular formula C37H62O9 and a molecular weight of 650.89 g/mol. Its IUPAC name is 2-[[8-hydroxy-4,8a-bis(hydroxymethyl)-14-methoxy-4,6a,6b,11,11,14b-hexamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-6-methyloxane-3,4,5-triol.
| Compound Name | 2-[[8-hydroxy-4,8a-bis(hydroxymethyl)-14-methoxy-4,6a,6b,11,11,14b-hexamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-6-methyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 162819239 |
| Molecular Formula | C37H62O9 |
| Molecular Weight | 650.89 g/mol |
| Exact Mass | 650.44 |
| IUPAC Name | 2-[[8-hydroxy-4,8a-bis(hydroxymethyl)-14-methoxy-4,6a,6b,11,11,14b-hexamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-6-methyloxane-3,4,5-triol |
| SMILES | COC1C=C2C3CC(C)(C)CCC3(CO)C(O)CC2(C)C2(C)CCC3C(C)(CO)C(OC4OC(C)C(O)C(O)C4O)CCC3(C)C12 |
| InChI | InChI=1S/C37H62O9/c1-20-27(41)28(42)29(43)31(45-20)46-26-10-11-33(4)24(34(26,5)18-38)9-12-35(6)30(33)23(44-8)15-21-22-16-32(2,3)13-14-37(22,19-39)25(40)17-36(21,35)7/h15,20,22-31,38-43H,9-14,16-19H2,1-8H3 |
| InChIKey | FICVTPIPOGXLJF-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 149.07 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.89 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'saponine_derivative', 'substructure': 'N/A'} |
|---|