C31H46O10 — CID 162819279
[2,3,5-trihydroxy-6-[5-hydroxy-6-methyl-3-(2-methylbut-2-enoyloxy)hepta-1,6-dien-2-yl]-3-methyl-4-(2-methylbut-2-enoyloxy)cyclohexyl] 3-methylpent-2-enoate (PubChem CID 162819279) has the molecular formula C31H46O10 and a molecular weight of 578.70 g/mol. Its IUPAC name is [2,3,5-trihydroxy-6-[5-hydroxy-6-methyl-3-(2-methylbut-2-enoyloxy)hepta-1,6-dien-2-yl]-3-methyl-4-(2-methylbut-2-enoyloxy)cyclohexyl] 3-methylpent-2-enoate.
| Compound Name | [2,3,5-trihydroxy-6-[5-hydroxy-6-methyl-3-(2-methylbut-2-enoyloxy)hepta-1,6-dien-2-yl]-3-methyl-4-(2-methylbut-2-enoyloxy)cyclohexyl] 3-methylpent-2-enoate |
|---|---|
| PubChem CID | 162819279 |
| Molecular Formula | C31H46O10 |
| Molecular Weight | 578.70 g/mol |
| Exact Mass | 578.31 |
| IUPAC Name | [2,3,5-trihydroxy-6-[5-hydroxy-6-methyl-3-(2-methylbut-2-enoyloxy)hepta-1,6-dien-2-yl]-3-methyl-4-(2-methylbut-2-enoyloxy)cyclohexyl] 3-methylpent-2-enoate |
| SMILES | C=C(C)C(O)CC(OC(=O)C(C)=CC)C(=C)C1C(O)C(OC(=O)C(C)=CC)C(C)(O)C(O)C1OC(=O)C=C(C)CC |
| InChI | InChI=1S/C31H46O10/c1-11-17(6)14-23(33)40-26-24(20(9)22(15-21(32)16(4)5)39-29(36)18(7)12-2)25(34)28(31(10,38)27(26)35)41-30(37)19(8)13-3/h12-14,21-22,24-28,32,34-35,38H,4,9,11,15H2,1-3,5-8,10H3 |
| InChIKey | NYAOMORZVGLFQV-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 159.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.70 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|