C36H62O9 — CID 162819287
2-[[3,12-dihydroxy-17-(6-hydroxy-6-methylhept-1-en-2-yl)-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-6-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 162819287) has the molecular formula C36H62O9 and a molecular weight of 638.88 g/mol. Its IUPAC name is 2-[[3,12-dihydroxy-17-(6-hydroxy-6-methylhept-1-en-2-yl)-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-6-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | 2-[[3,12-dihydroxy-17-(6-hydroxy-6-methylhept-1-en-2-yl)-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-6-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 162819287 |
| Molecular Formula | C36H62O9 |
| Molecular Weight | 638.88 g/mol |
| Exact Mass | 638.44 |
| IUPAC Name | 2-[[3,12-dihydroxy-17-(6-hydroxy-6-methylhept-1-en-2-yl)-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-6-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | C=C(CCCC(C)(C)O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3C(OC3OC(CO)C(O)C(O)C3O)CC12C |
| InChI | InChI=1S/C36H62O9/c1-19(10-9-13-32(2,3)43)20-11-15-35(7)26(20)21(38)16-24-34(6)14-12-25(39)33(4,5)30(34)22(17-36(24,35)8)44-31-29(42)28(41)27(40)23(18-37)45-31/h20-31,37-43H,1,9-18H2,2-8H3 |
| InChIKey | NAZVBLNKFABUDF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 160.07 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.88 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'saponine_derivative', 'substructure': 'N/A'} |
|---|