C30H52O5 — CID 162819304
(3E,12E)-16,17-dihydroxy-1-[(2R,5S)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-4,9,13,17-tetramethyloctadeca-3,8,12-trien-2-one (PubChem CID 162819304) has the molecular formula C30H52O5 and a molecular weight of 492.74 g/mol. Its IUPAC name is (3E,12E)-16,17-dihydroxy-1-[(2R,5S)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-4,9,13,17-tetramethyloctadeca-3,8,12-trien-2-one.
| Compound Name | (3E,12E)-16,17-dihydroxy-1-[(2R,5S)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-4,9,13,17-tetramethyloctadeca-3,8,12-trien-2-one |
|---|---|
| PubChem CID | 162819304 |
| Molecular Formula | C30H52O5 |
| Molecular Weight | 492.74 g/mol |
| Exact Mass | 492.38 |
| IUPAC Name | (3E,12E)-16,17-dihydroxy-1-[(2R,5S)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-4,9,13,17-tetramethyloctadeca-3,8,12-trien-2-one |
| SMILES | CC(=CCCC/C(C)=C/C(=O)C[C@@]1(C)CC[C@@H](C(C)(C)O)O1)CC/C=C(\C)CCC(O)C(C)(C)O |
| InChI | InChI=1S/C30H52O5/c1-22(14-11-15-23(2)16-17-26(32)28(4,5)33)12-9-10-13-24(3)20-25(31)21-30(8)19-18-27(35-30)29(6,7)34/h12,15,20,26-27,32-34H,9-11,13-14,16-19,21H2,1-8H3/b22-12?,23-15+,24-20+/t26?,27-,30+/m0/s1 |
| InChIKey | ACQJQRDRWQGINF-VWKKOVPFSA-N |
| XLogP | 6.36 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.74 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|