C19H32O9 — CID 162820116
(2S)-2-[(1S)-1-[(2R,3S,4R,5R,6R)-3-hydroxy-6-(hydroxymethyl)-4,5-dimethoxyoxan-2-yl]oxypentyl]-4-methoxy-2,3-dihydropyran-6-one (PubChem CID 162820116) has the molecular formula C19H32O9 and a molecular weight of 404.46 g/mol. Its IUPAC name is (2S)-2-[(1S)-1-[(2R,3S,4R,5R,6R)-3-hydroxy-6-(hydroxymethyl)-4,5-dimethoxyoxan-2-yl]oxypentyl]-4-methoxy-2,3-dihydropyran-6-one.
| Compound Name | (2S)-2-[(1S)-1-[(2R,3S,4R,5R,6R)-3-hydroxy-6-(hydroxymethyl)-4,5-dimethoxyoxan-2-yl]oxypentyl]-4-methoxy-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 162820116 |
| Molecular Formula | C19H32O9 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | (2S)-2-[(1S)-1-[(2R,3S,4R,5R,6R)-3-hydroxy-6-(hydroxymethyl)-4,5-dimethoxyoxan-2-yl]oxypentyl]-4-methoxy-2,3-dihydropyran-6-one |
| SMILES | CCCC[C@H](O[C@@H]1O[C@H](CO)[C@@H](OC)[C@H](OC)[C@@H]1O)[C@@H]1CC(OC)=CC(=O)O1 |
| InChI | InChI=1S/C19H32O9/c1-5-6-7-12(13-8-11(23-2)9-15(21)26-13)27-19-16(22)18(25-4)17(24-3)14(10-20)28-19/h9,12-14,16-20,22H,5-8,10H2,1-4H3/t12-,13-,14+,16-,17+,18+,19+/m0/s1 |
| InChIKey | OLPZITFOWYCLMF-VUAAKQTLSA-N |
| XLogP | 0.52 |
| TPSA | 112.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |