C37H56O6 — CID 162820179
methyl 3-[(2R,3R)-6-[(2,2-dimethyl-3-prop-1-en-2-ylcyclobutyl)methyl]-5-methoxy-2,3-dimethyl-6-(3-methylbut-2-enyl)-4,7-dioxo-2,3-dihydrochromen-8-yl]nonanoate (PubChem CID 162820179) has the molecular formula C37H56O6 and a molecular weight of 596.85 g/mol. Its IUPAC name is methyl 3-[(2R,3R)-6-[(2,2-dimethyl-3-prop-1-en-2-ylcyclobutyl)methyl]-5-methoxy-2,3-dimethyl-6-(3-methylbut-2-enyl)-4,7-dioxo-2,3-dihydrochromen-8-yl]nonanoate.
| Compound Name | methyl 3-[(2R,3R)-6-[(2,2-dimethyl-3-prop-1-en-2-ylcyclobutyl)methyl]-5-methoxy-2,3-dimethyl-6-(3-methylbut-2-enyl)-4,7-dioxo-2,3-dihydrochromen-8-yl]nonanoate |
|---|---|
| PubChem CID | 162820179 |
| Molecular Formula | C37H56O6 |
| Molecular Weight | 596.85 g/mol |
| Exact Mass | 596.41 |
| IUPAC Name | methyl 3-[(2R,3R)-6-[(2,2-dimethyl-3-prop-1-en-2-ylcyclobutyl)methyl]-5-methoxy-2,3-dimethyl-6-(3-methylbut-2-enyl)-4,7-dioxo-2,3-dihydrochromen-8-yl]nonanoate |
| SMILES | C=C(C)C1CC(CC2(CC=C(C)C)C(=O)C(C(CCCCCC)CC(=O)OC)=C3O[C@H](C)[C@@H](C)C(=O)C3=C2OC)C1(C)C |
| InChI | InChI=1S/C37H56O6/c1-12-13-14-15-16-26(19-29(38)41-10)30-33-31(32(39)24(6)25(7)43-33)35(42-11)37(34(30)40,18-17-22(2)3)21-27-20-28(23(4)5)36(27,8)9/h17,24-28H,4,12-16,18-21H2,1-3,5-11H3/t24-,25-,26?,27?,28?,37?/m1/s1 |
| InChIKey | CHSVUHPQJDFPKU-KTZXMZFHSA-N |
| XLogP | 8.47 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.85 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|