C34H50O6 — CID 162820211
methyl 3-[(2R,3R)-6-[(2,2-dimethyl-3-prop-1-en-2-ylcyclobutyl)methyl]-5-methoxy-2,3-dimethyl-6-(3-methylbut-2-enyl)-4,7-dioxo-2,3-dihydrochromen-8-yl]hexanoate (PubChem CID 162820211) has the molecular formula C34H50O6 and a molecular weight of 554.77 g/mol. Its IUPAC name is methyl 3-[(2R,3R)-6-[(2,2-dimethyl-3-prop-1-en-2-ylcyclobutyl)methyl]-5-methoxy-2,3-dimethyl-6-(3-methylbut-2-enyl)-4,7-dioxo-2,3-dihydrochromen-8-yl]hexanoate.
| Compound Name | methyl 3-[(2R,3R)-6-[(2,2-dimethyl-3-prop-1-en-2-ylcyclobutyl)methyl]-5-methoxy-2,3-dimethyl-6-(3-methylbut-2-enyl)-4,7-dioxo-2,3-dihydrochromen-8-yl]hexanoate |
|---|---|
| PubChem CID | 162820211 |
| Molecular Formula | C34H50O6 |
| Molecular Weight | 554.77 g/mol |
| Exact Mass | 554.36 |
| IUPAC Name | methyl 3-[(2R,3R)-6-[(2,2-dimethyl-3-prop-1-en-2-ylcyclobutyl)methyl]-5-methoxy-2,3-dimethyl-6-(3-methylbut-2-enyl)-4,7-dioxo-2,3-dihydrochromen-8-yl]hexanoate |
| SMILES | C=C(C)C1CC(CC2(CC=C(C)C)C(=O)C(C(CCC)CC(=O)OC)=C3O[C@H](C)[C@@H](C)C(=O)C3=C2OC)C1(C)C |
| InChI | InChI=1S/C34H50O6/c1-12-13-23(16-26(35)38-10)27-30-28(29(36)21(6)22(7)40-30)32(39-11)34(31(27)37,15-14-19(2)3)18-24-17-25(20(4)5)33(24,8)9/h14,21-25H,4,12-13,15-18H2,1-3,5-11H3/t21-,22-,23?,24?,25?,34?/m1/s1 |
| InChIKey | VBLVXMWELLTNAI-XSXDNLPQSA-N |
| XLogP | 7.30 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.77 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|